C12H14F4O2 — CID 15312550
3-(1,1,2,2-tetrafluoroethyl)-2-oxaspiro[5.5]undec-3-en-5-one (PubChem CID 15312550) has the molecular formula C12H14F4O2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethyl)-2-oxaspiro[5.5]undec-3-en-5-one.
| Compound Name | 3-(1,1,2,2-tetrafluoroethyl)-2-oxaspiro[5.5]undec-3-en-5-one |
|---|---|
| PubChem CID | 15312550 |
| Molecular Formula | C12H14F4O2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethyl)-2-oxaspiro[5.5]undec-3-en-5-one |
| SMILES | O=C1C=C(C(F)(F)C(F)F)OCC12CCCCC2 |
| InChI | InChI=1S/C12H14F4O2/c13-10(14)12(15,16)9-6-8(17)11(7-18-9)4-2-1-3-5-11/h6,10H,1-5,7H2 |
| InChIKey | HAUJOKDOJSAQJZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|