C11H16F2O2 — CID 103206642
1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103206642) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206642 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C11H16F2O2/c12-11(13)8-15-7-6-10(14)9-4-2-1-3-5-9/h4,11H,1-3,5-8H2 |
| InChIKey | PMYOXCWKAOXIPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|