C28H37F3O5 — CID 162201425
2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,5-trimethyl-6-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 162201425) has the molecular formula C28H37F3O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,5-trimethyl-6-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,5-trimethyl-6-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 162201425 |
| Molecular Formula | C28H37F3O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,5-trimethyl-6-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCCCCCCCOCC(F)(F)F)=C(C)C1=O.CC1=CC(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C19H27F3O3.C9H10O2/c1-13-14(2)18(24)16(15(3)17(13)23)10-8-6-4-5-7-9-11-25-12-19(20,21)22;1-5-4-8(10)6(2)7(3)9(5)11/h4-12H2,1-3H3;4H,1-3H3 |
| InChIKey | ZRQDPJFGNJJOLE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|