C28H16F12NOP — CID 100939425
(S)-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]-pyridin-2-ylmethanol (PubChem CID 100939425) has the molecular formula C28H16F12NOP and a molecular weight of 641.39 g/mol. Its IUPAC name is (S)-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]-pyridin-2-ylmethanol.
| Compound Name | (S)-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 100939425 |
| Molecular Formula | C28H16F12NOP |
| Molecular Weight | 641.39 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | (S)-[2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanylphenyl]-pyridin-2-ylmethanol |
| SMILES | O[C@H](c1ccccn1)c1ccccc1P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H16F12NOP/c29-25(30,31)15-9-16(26(32,33)34)12-19(11-15)43(20-13-17(27(35,36)37)10-18(14-20)28(38,39)40)23-7-2-1-5-21(23)24(42)22-6-3-4-8-41-22/h1-14,24,42H/t24-/m0/s1 |
| InChIKey | FBFYXJWOYASDAS-DEOSSOPVSA-N |
| XLogP | 8.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.39 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|