About N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide
N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide (PubChem CID 100940866) has the molecular formula C17H16F2N4O
and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide.
Molecular Properties
| Compound Name | N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide |
| PubChem CID | 100940866 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide |
| SMILES | CC(C)n1c(N)nc2ccc(NC(=O)c3cccc(F)c3F)cc21 |
| InChI | InChI=1S/C17H16F2N4O/c1-9(2)23-14-8-10(6-7-13(14)22-17(23)20)21-16(24)11-4-3-5-12(18)15(11)19/h3-9H,1-2H3,(H2,20,22)(H,21,24) |
| InChIKey | WKLPFMBEJODTCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide?
The IUPAC name of N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide (CID 100940866) is N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide.
What is the SMILES notation for N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide?
The canonical SMILES for N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide is CC(C)n1c(N)nc2ccc(NC(=O)c3cccc(F)c3F)cc21.
What is the InChIKey of N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide?
The InChIKey is WKLPFMBEJODTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N4O/c1-9(2)23-14-8-10(6-7-13(14)22-17(23)20)21-16(24)11-4-3-5-12(18)15(11)19/h3-9H,1-2H3,(H2,20,22)(H,21,24).
What are the key properties of N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide?
N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide has a molecular weight of 330.34 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-3-propan-2-ylbenzimidazol-5-yl)-2,3-difluorobenzamide is sourced from PubChem (CID 100940866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).