C19H30N3O3P — CID 100941304
ethyl 2-[[(3aS,7aS)-1,3-dimethyl-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-methylamino]-2-phenylacetate (PubChem CID 100941304) has the molecular formula C19H30N3O3P and a molecular weight of 379.44 g/mol. Its IUPAC name is ethyl 2-[[(3aS,7aS)-1,3-dimethyl-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-methylamino]-2-phenylacetate.
| Compound Name | ethyl 2-[[(3aS,7aS)-1,3-dimethyl-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 100941304 |
| Molecular Formula | C19H30N3O3P |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | ethyl 2-[[(3aS,7aS)-1,3-dimethyl-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-methylamino]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N(C)[P+]1([O-])N(C)[C@H]2CCCC[C@@H]2N1C |
| InChI | InChI=1S/C19H30N3O3P/c1-5-25-19(23)18(15-11-7-6-8-12-15)22(4)26(24)20(2)16-13-9-10-14-17(16)21(26)3/h6-8,11-12,16-18H,5,9-10,13-14H2,1-4H3/t16-,17-,18?/m0/s1 |
| InChIKey | DTBSMFAZVZUZLA-UBFHEZILSA-N |
| XLogP | 2.45 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|