C13H21NO3 — CID 100944052
tert-butyl (3R,5S)-5-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 100944052) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl (3R,5S)-5-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-5-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100944052 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl (3R,5S)-5-methyl-2-oxo-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1C[C@H](C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H21NO3/c1-6-7-10-8-9(2)14(11(10)15)12(16)17-13(3,4)5/h6,9-10H,1,7-8H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | DOWWOBYQVLNHKE-VHSXEESVSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|