C16H23F2NO3 — CID 123674655
tert-butyl 5-(difluoromethyl)-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate (PubChem CID 123674655) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl 5-(difluoromethyl)-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-(difluoromethyl)-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123674655 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl 5-(difluoromethyl)-2-oxo-3,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC1(CC=C)CC(C(F)F)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C16H23F2NO3/c1-6-8-16(9-7-2)10-11(12(17)18)19(13(16)20)14(21)22-15(3,4)5/h6-7,11-12H,1-2,8-10H2,3-5H3 |
| InChIKey | WVCXTVCHVYKRGI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|