C12H19NO3 — CID 123486758
tert-butyl (2S,3R)-3-ethenyl-5-oxo-2-(tritiomethyl)pyrrolidine-1-carboxylate (PubChem CID 123486758) has the molecular formula C12H19NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-ethenyl-5-oxo-2-(tritiomethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-ethenyl-5-oxo-2-(tritiomethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123486758 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | tert-butyl (2S,3R)-3-ethenyl-5-oxo-2-(tritiomethyl)pyrrolidine-1-carboxylate |
| SMILES | [3H]C[C@H]1[C@@H](C=C)CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO3/c1-6-9-7-10(14)13(8(9)2)11(15)16-12(3,4)5/h6,8-9H,1,7H2,2-5H3/t8-,9-/m0/s1/i2T |
| InChIKey | XYMDYGKHNYQVDA-SRWYDJLMSA-N |
| XLogP | 2.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|