C12H16O3S — CID 100944559
(2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyloxolane (PubChem CID 100944559) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyloxolane.
| Compound Name | (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 100944559 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (2R,3S,5S)-3-(benzenesulfonyl)-2,5-dimethyloxolane |
| SMILES | C[C@H]1C[C@H](S(=O)(=O)c2ccccc2)[C@@H](C)O1 |
| InChI | InChI=1S/C12H16O3S/c1-9-8-12(10(2)15-9)16(13,14)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3/t9-,10+,12-/m0/s1 |
| InChIKey | KZMBYGBFWLBGJT-UMNHJUIQSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |