C23H18FN3OS2 — CID 10094511
5-(4-fluorophenyl)-2-[(2-methylsulfinylphenyl)methylsulfanyl]-4-pyridin-4-ylpyrimidine (PubChem CID 10094511) has the molecular formula C23H18FN3OS2 and a molecular weight of 435.55 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[(2-methylsulfinylphenyl)methylsulfanyl]-4-pyridin-4-ylpyrimidine.
| Compound Name | 5-(4-fluorophenyl)-2-[(2-methylsulfinylphenyl)methylsulfanyl]-4-pyridin-4-ylpyrimidine |
|---|---|
| PubChem CID | 10094511 |
| Molecular Formula | C23H18FN3OS2 |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[(2-methylsulfinylphenyl)methylsulfanyl]-4-pyridin-4-ylpyrimidine |
| SMILES | CS(=O)c1ccccc1CSc1ncc(-c2ccc(F)cc2)c(-c2ccncc2)n1 |
| InChI | InChI=1S/C23H18FN3OS2/c1-30(28)21-5-3-2-4-18(21)15-29-23-26-14-20(16-6-8-19(24)9-7-16)22(27-23)17-10-12-25-13-11-17/h2-14H,15H2,1H3 |
| InChIKey | VIGHOCFNNZKRLV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |