C19H20FN5O2S — CID 90313798
2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-tert-butylbenzenesulfonamide (PubChem CID 90313798) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-tert-butylbenzenesulfonamide.
| Compound Name | 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 90313798 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[6-(2-aminopyrimidin-5-yl)-5-fluoro-3-pyridinyl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1cnc(-c2cnc(N)nc2)c(F)c1 |
| InChI | InChI=1S/C19H20FN5O2S/c1-19(2,3)25-28(26,27)16-7-5-4-6-14(16)12-8-15(20)17(22-9-12)13-10-23-18(21)24-11-13/h4-11,25H,1-3H3,(H2,21,23,24) |
| InChIKey | PPXJXQJZJRXYKC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |