C40H44O12 — CID 100945228
[(2R,3R)-8-[(2R,4R)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dimethoxy-2-(2,3,4-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 100945228) has the molecular formula C40H44O12 and a molecular weight of 716.78 g/mol. Its IUPAC name is [(2R,3R)-8-[(2R,4R)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dimethoxy-2-(2,3,4-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [(2R,3R)-8-[(2R,4R)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dimethoxy-2-(2,3,4-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 100945228 |
| Molecular Formula | C40H44O12 |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.28 |
| IUPAC Name | [(2R,3R)-8-[(2R,4R)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-5,7-dimethoxy-2-(2,3,4-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | COc1ccc2c(c1)O[C@@H](c1ccc(OC)c(OC)c1)C[C@H]2c1c(OC)cc(OC)c2c1O[C@H](c1ccc(OC)c(OC)c1OC)[C@H](OC(C)=O)C2 |
| InChI | InChI=1S/C40H44O12/c1-21(41)50-35-19-27-31(45-5)20-34(47-7)36(38(27)52-37(35)25-13-15-29(44-4)40(49-9)39(25)48-8)26-18-30(22-10-14-28(43-3)33(16-22)46-6)51-32-17-23(42-2)11-12-24(26)32/h10-17,20,26,30,35,37H,18-19H2,1-9H3/t26-,30-,35-,37-/m1/s1 |
| InChIKey | RRAUTKGQJYXCGO-SEUWDGBYSA-N |
| XLogP | 7.02 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |