C42H46O14 — CID 636315
[5-[3-acetyloxy-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 636315) has the molecular formula C42H46O14 and a molecular weight of 774.82 g/mol. Its IUPAC name is [5-[3-acetyloxy-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [5-[3-acetyloxy-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 636315 |
| Molecular Formula | C42H46O14 |
| Molecular Weight | 774.82 g/mol |
| Exact Mass | 774.29 |
| IUPAC Name | [5-[3-acetyloxy-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3,4-dihydro-2H-chromen-8-yl]-2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | COc1ccc(C2Oc3c(c(-c4c(OC)cc(OC)c5c4OC(c4ccc(OC)c(OC)c4)C(OC(C)=O)C5)cc(OC)c3OC)CC2OC(C)=O)cc1OC |
| InChI | InChI=1S/C42H46O14/c1-21(43)53-35-18-26-25(17-34(51-9)42(52-10)41(26)56-39(35)24-12-14-29(46-4)32(16-24)49-7)37-33(50-8)20-30(47-5)27-19-36(54-22(2)44)38(55-40(27)37)23-11-13-28(45-3)31(15-23)48-6/h11-17,20,35-36,38-39H,18-19H2,1-10H3 |
| InChIKey | UBLSSMATXZFSQO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |