C20H20O8 — CID 102211562
[(2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5,8-dioxo-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 102211562) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is [(2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5,8-dioxo-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [(2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5,8-dioxo-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 102211562 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(2R,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5,8-dioxo-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | COC1=CC(=O)C2=C(O[C@H](c3ccc(OC)c(OC)c3)[C@@H](OC(C)=O)C2)C1=O |
| InChI | InChI=1S/C20H20O8/c1-10(21)27-17-8-12-13(22)9-16(26-4)18(23)20(12)28-19(17)11-5-6-14(24-2)15(7-11)25-3/h5-7,9,17,19H,8H2,1-4H3/t17-,19+/m0/s1 |
| InChIKey | HEYKXGGIMTTXKO-PKOBYXMFSA-N |
| XLogP | 2.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|