C12H20O4 — CID 100945318
tert-butyl (3S,3aS,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylate (PubChem CID 100945318) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl (3S,3aS,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylate.
| Compound Name | tert-butyl (3S,3aS,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 100945318 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | tert-butyl (3S,3aS,7aS)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CO[C@H]2CCCO[C@H]21 |
| InChI | InChI=1S/C12H20O4/c1-12(2,3)16-11(13)8-7-15-9-5-4-6-14-10(8)9/h8-10H,4-7H2,1-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | ZOFHKYOCSNEVTD-GUBZILKMSA-N |
| XLogP | 1.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |