C8H11IO3 — CID 134989246
(3S,3aS,7R,7aR)-7-iodo-3-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one (PubChem CID 134989246) has the molecular formula C8H11IO3 and a molecular weight of 282.08 g/mol. Its IUPAC name is (3S,3aS,7R,7aR)-7-iodo-3-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3S,3aS,7R,7aR)-7-iodo-3-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 134989246 |
| Molecular Formula | C8H11IO3 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | (3S,3aS,7R,7aR)-7-iodo-3-methyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
| SMILES | C[C@@H]1C(=O)O[C@@H]2[C@H]1OCC[C@H]2I |
| InChI | InChI=1S/C8H11IO3/c1-4-6-7(12-8(4)10)5(9)2-3-11-6/h4-7H,2-3H2,1H3/t4-,5+,6-,7-/m0/s1 |
| InChIKey | ORTQFLGMFFGZSK-VZFHVOOUSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|