C8H12O4 — CID 100945320
(3R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylic acid (PubChem CID 100945320) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylic acid.
| Compound Name | (3R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 100945320 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CO[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C8H12O4/c9-8(10)5-4-12-6-2-1-3-11-7(5)6/h5-7H,1-4H2,(H,9,10)/t5-,6-,7-/m1/s1 |
| InChIKey | SNJOACVJYLECIQ-FSDSQADBSA-N |
| XLogP | 0.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |