C15H26O7 — CID 142342498
acetic acid;[(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate;ethane (PubChem CID 142342498) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is acetic acid;[(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate;ethane.
| Compound Name | acetic acid;[(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate;ethane |
|---|---|
| PubChem CID | 142342498 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | acetic acid;[(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate;ethane |
| SMILES | CC.CC(=O)O.CC(=O)OC1C[C@H]2OC(=O)C(C)C2O[C@H]1C |
| InChI | InChI=1S/C11H16O5.C2H4O2.C2H6/c1-5-10-9(16-11(5)13)4-8(6(2)14-10)15-7(3)12;1-2(3)4;1-2/h5-6,8-10H,4H2,1-3H3;1H3,(H,3,4);1-2H3/t5?,6-,8?,9+,10?;;/m0../s1 |
| InChIKey | QDRBZBNTFYCKRM-YEYZXUQRSA-N |
| XLogP | 1.77 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |