C15H15Cl2N2O9P — CID 100945675
(2,5-dichlorophenyl) [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate (PubChem CID 100945675) has the molecular formula C15H15Cl2N2O9P and a molecular weight of 469.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl) [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate.
| Compound Name | (2,5-dichlorophenyl) [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 100945675 |
| Molecular Formula | C15H15Cl2N2O9P |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | (2,5-dichlorophenyl) [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)Oc3cc(Cl)ccc3Cl)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C15H15Cl2N2O9P/c16-7-1-2-8(17)9(5-7)27-29(24,25)28-13-10(6-20)26-14(12(13)22)19-4-3-11(21)18-15(19)23/h1-5,10,12-14,20,22H,6H2,(H,24,25)(H,18,21,23)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | LDCKYVNNOWKGKY-FMKGYKFTSA-N |
| XLogP | 0.66 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|