C29H33N3O6 — CID 100945695
(18S)-18-ethyl-18-hydroxy-2-[2-(2-methylbutylamino)ethyl]-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione (PubChem CID 100945695) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is (18S)-18-ethyl-18-hydroxy-2-[2-(2-methylbutylamino)ethyl]-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione.
| Compound Name | (18S)-18-ethyl-18-hydroxy-2-[2-(2-methylbutylamino)ethyl]-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione |
|---|---|
| PubChem CID | 100945695 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | (18S)-18-ethyl-18-hydroxy-2-[2-(2-methylbutylamino)ethyl]-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione |
| SMILES | CCC(C)CNCCc1c2c(nc3cc4c(cc13)OCCO4)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C29H33N3O6/c1-4-16(3)13-30-7-6-17-18-10-24-25(37-9-8-36-24)12-22(18)31-26-19(17)14-32-23(26)11-21-20(27(32)33)15-38-28(34)29(21,35)5-2/h10-12,16,30,35H,4-9,13-15H2,1-3H3/t16?,29-/m0/s1 |
| InChIKey | HCYDKNZCBDCGFI-GSJMWFLZSA-N |
| XLogP | 3.03 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|