C27H23N4O6+ — CID 10097407
(18S)-18-ethyl-18-hydroxy-2-(pyrazin-1-ium-1-ylmethyl)-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione (PubChem CID 10097407) has the molecular formula C27H23N4O6+ and a molecular weight of 499.50 g/mol. Its IUPAC name is (18S)-18-ethyl-18-hydroxy-2-(pyrazin-1-ium-1-ylmethyl)-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione.
| Compound Name | (18S)-18-ethyl-18-hydroxy-2-(pyrazin-1-ium-1-ylmethyl)-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione |
|---|---|
| PubChem CID | 10097407 |
| Molecular Formula | C27H23N4O6+ |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (18S)-18-ethyl-18-hydroxy-2-(pyrazin-1-ium-1-ylmethyl)-6,9,20-trioxa-13,24-diazahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-1,3,5(10),11,13,15,17(22)-heptaene-19,23-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2C[n+]1ccncc1)OCCO3 |
| InChI | InChI=1S/C27H23N4O6/c1-2-27(34)19-10-21-24-17(13-31(21)25(32)18(19)14-37-26(27)33)16(12-30-5-3-28-4-6-30)15-9-22-23(11-20(15)29-24)36-8-7-35-22/h3-6,9-11,34H,2,7-8,12-14H2,1H3/q+1/t27-/m0/s1 |
| InChIKey | SXEKZVUTWLJFNH-MHZLTWQESA-N |
| XLogP | 1.58 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|