C21H27BO2S — CID 100946593
(4R,5S)-4-hexyl-2-phenyl-5-(phenylsulfanylmethyl)-1,3,2-dioxaborolane (PubChem CID 100946593) has the molecular formula C21H27BO2S and a molecular weight of 354.32 g/mol. Its IUPAC name is (4R,5S)-4-hexyl-2-phenyl-5-(phenylsulfanylmethyl)-1,3,2-dioxaborolane.
| Compound Name | (4R,5S)-4-hexyl-2-phenyl-5-(phenylsulfanylmethyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 100946593 |
| Molecular Formula | C21H27BO2S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (4R,5S)-4-hexyl-2-phenyl-5-(phenylsulfanylmethyl)-1,3,2-dioxaborolane |
| SMILES | CCCCCC[C@H]1OB(c2ccccc2)O[C@@H]1CSc1ccccc1 |
| InChI | InChI=1S/C21H27BO2S/c1-2-3-4-11-16-20-21(17-25-19-14-9-6-10-15-19)24-22(23-20)18-12-7-5-8-13-18/h5-10,12-15,20-21H,2-4,11,16-17H2,1H3/t20-,21-/m1/s1 |
| InChIKey | MEMFLMRXWNDFQT-NHCUHLMSSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|