C15H22BN3O2 — CID 15400780
(4R,5S)-5-azido-4-hexyl-2-phenyl-1,3,2-dioxaborinane (PubChem CID 15400780) has the molecular formula C15H22BN3O2 and a molecular weight of 287.17 g/mol. Its IUPAC name is (4R,5S)-5-azido-4-hexyl-2-phenyl-1,3,2-dioxaborinane.
| Compound Name | (4R,5S)-5-azido-4-hexyl-2-phenyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 15400780 |
| Molecular Formula | C15H22BN3O2 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (4R,5S)-5-azido-4-hexyl-2-phenyl-1,3,2-dioxaborinane |
| SMILES | CCCCCC[C@H]1OB(c2ccccc2)OC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C15H22BN3O2/c1-2-3-4-8-11-15-14(18-19-17)12-20-16(21-15)13-9-6-5-7-10-13/h5-7,9-10,14-15H,2-4,8,11-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | YCWJBQXJYFHSOH-LSDHHAIUSA-N |
| XLogP | 3.45 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|