C16H25BO2 — CID 140912487
2-(3,5-dimethylphenyl)-4-hexyl-1,3,2-dioxaborolane (PubChem CID 140912487) has the molecular formula C16H25BO2 and a molecular weight of 260.19 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-hexyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,5-dimethylphenyl)-4-hexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140912487 |
| Molecular Formula | C16H25BO2 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-hexyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCC1COB(c2cc(C)cc(C)c2)O1 |
| InChI | InChI=1S/C16H25BO2/c1-4-5-6-7-8-16-12-18-17(19-16)15-10-13(2)9-14(3)11-15/h9-11,16H,4-8,12H2,1-3H3 |
| InChIKey | YYMAKTUCSCIMLT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|