C24H24BrNO3S — CID 100947611
(Z)-5-bromo-6-(4-methylphenyl)sulfonyl-N-(naphthalen-1-ylmethyl)hex-5-enamide (PubChem CID 100947611) has the molecular formula C24H24BrNO3S and a molecular weight of 486.43 g/mol. Its IUPAC name is (Z)-5-bromo-6-(4-methylphenyl)sulfonyl-N-(naphthalen-1-ylmethyl)hex-5-enamide.
| Compound Name | (Z)-5-bromo-6-(4-methylphenyl)sulfonyl-N-(naphthalen-1-ylmethyl)hex-5-enamide |
|---|---|
| PubChem CID | 100947611 |
| Molecular Formula | C24H24BrNO3S |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | (Z)-5-bromo-6-(4-methylphenyl)sulfonyl-N-(naphthalen-1-ylmethyl)hex-5-enamide |
| SMILES | Cc1ccc(S(=O)(=O)/C=C(\Br)CCCC(=O)NCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H24BrNO3S/c1-18-12-14-22(15-13-18)30(28,29)17-21(25)9-5-11-24(27)26-16-20-8-4-7-19-6-2-3-10-23(19)20/h2-4,6-8,10,12-15,17H,5,9,11,16H2,1H3,(H,26,27)/b21-17- |
| InChIKey | LYIYOKIZGNTJHG-FXBPSFAMSA-N |
| XLogP | 5.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |