C22H23N3O4S — CID 27681328
N,4-dimethyl-N-[2-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide (PubChem CID 27681328) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[2-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27681328 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N,4-dimethyl-N-[2-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NNC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-16-10-12-19(13-11-16)30(28,29)25(2)15-22(27)24-23-21(26)14-18-8-5-7-17-6-3-4-9-20(17)18/h3-13H,14-15H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | LXGVNWQFUUNWKQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|