C19H24N4O7S2 — CID 24636720
N-[2-[2-[2-[(4-methoxyphenyl)sulfonylamino]acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 24636720) has the molecular formula C19H24N4O7S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[2-[2-[2-[(4-methoxyphenyl)sulfonylamino]acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[2-[(4-methoxyphenyl)sulfonylamino]acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24636720 |
| Molecular Formula | C19H24N4O7S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[2-[2-[2-[(4-methoxyphenyl)sulfonylamino]acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NNC(=O)CN(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O7S2/c1-14-4-8-17(9-5-14)32(28,29)23(2)13-19(25)22-21-18(24)12-20-31(26,27)16-10-6-15(30-3)7-11-16/h4-11,20H,12-13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | UWSKQKSEXURVTA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|