C21H27N3O4S — CID 40626111
N,4-dimethyl-N-[2-oxo-2-[2-[(2R)-2-phenylpentanoyl]hydrazinyl]ethyl]benzenesulfonamide (PubChem CID 40626111) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-oxo-2-[2-[(2R)-2-phenylpentanoyl]hydrazinyl]ethyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[2-oxo-2-[2-[(2R)-2-phenylpentanoyl]hydrazinyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40626111 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N,4-dimethyl-N-[2-oxo-2-[2-[(2R)-2-phenylpentanoyl]hydrazinyl]ethyl]benzenesulfonamide |
| SMILES | CCC[C@@H](C(=O)NNC(=O)CN(C)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-4-8-19(17-9-6-5-7-10-17)21(26)23-22-20(25)15-24(3)29(27,28)18-13-11-16(2)12-14-18/h5-7,9-14,19H,4,8,15H2,1-3H3,(H,22,25)(H,23,26)/t19-/m1/s1 |
| InChIKey | JLGIKEDJVZXYFX-LJQANCHMSA-N |
| XLogP | 2.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|