C22H29N5O5S — CID 46643151
1-[3-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxobutan-2-yl]-3-phenylurea (PubChem CID 46643151) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[3-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxobutan-2-yl]-3-phenylurea.
| Compound Name | 1-[3-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxobutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 46643151 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-[3-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxobutan-2-yl]-3-phenylurea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NNC(=O)C(NC(=O)Nc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H29N5O5S/c1-15(2)20(24-22(30)23-17-8-6-5-7-9-17)21(29)26-25-19(28)14-27(4)33(31,32)18-12-10-16(3)11-13-18/h5-13,15,20H,14H2,1-4H3,(H,25,28)(H,26,29)(H2,23,24,30) |
| InChIKey | GVIHIGAKACAYTG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|