C19H26N6O3 — CID 46643358
1-[1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea (PubChem CID 46643358) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-[1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea.
| Compound Name | 1-[1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 46643358 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-[1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-phenylurea |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)C(NC(=O)Nc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C19H26N6O3/c1-12(2)17(21-19(28)20-15-8-6-5-7-9-15)18(27)23-22-16(26)11-25-14(4)10-13(3)24-25/h5-10,12,17H,11H2,1-4H3,(H,22,26)(H,23,27)(H2,20,21,28) |
| InChIKey | QWBYKUZRFJFDHN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|