C17H22N4O2S — CID 9428621
(2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide (PubChem CID 9428621) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide.
| Compound Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 9428621 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(4-methylphenyl)sulfanylpropanehydrazide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)NNC(=O)Cn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-11-5-7-15(8-6-11)24-14(4)17(23)19-18-16(22)10-21-13(3)9-12(2)20-21/h5-9,14H,10H2,1-4H3,(H,18,22)(H,19,23)/t14-/m0/s1 |
| InChIKey | FSSREPOJEGIQER-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|