C21H29N5O4 — CID 7613435
N-[(2S)-1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide (PubChem CID 7613435) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[(2S)-1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide.
| Compound Name | N-[(2S)-1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 7613435 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N-[(2S)-1-[2-[2-(3,5-dimethylpyrazol-1-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)N[C@H](C(=O)NNC(=O)Cn1nc(C)cc1C)C(C)C |
| InChI | InChI=1S/C21H29N5O4/c1-6-30-17-10-8-7-9-16(17)20(28)22-19(13(2)3)21(29)24-23-18(27)12-26-15(5)11-14(4)25-26/h7-11,13,19H,6,12H2,1-5H3,(H,22,28)(H,23,27)(H,24,29)/t19-/m0/s1 |
| InChIKey | FCSKAMUQHBFSDK-IBGZPJMESA-N |
| XLogP | 1.50 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|