C24H27N5O4 — CID 41272254
2-ethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]benzamide (PubChem CID 41272254) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-ethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 2-ethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 41272254 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-ethoxy-N-[(2S)-3-methyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)N[C@H](C(=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1)C(C)C |
| InChI | InChI=1S/C24H27N5O4/c1-4-33-20-13-9-8-12-17(20)22(30)25-21(15(2)3)24(32)29-28-23(31)19-14-18(26-27-19)16-10-6-5-7-11-16/h5-15,21H,4H2,1-3H3,(H,25,30)(H,26,27)(H,28,31)(H,29,32)/t21-/m0/s1 |
| InChIKey | FEXPCWLQCFSRET-NRFANRHFSA-N |
| XLogP | 2.69 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|