C17H27N5O5S — CID 55350391
[4-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxopentan-2-yl]urea (PubChem CID 55350391) has the molecular formula C17H27N5O5S and a molecular weight of 413.50 g/mol. Its IUPAC name is [4-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxopentan-2-yl]urea.
| Compound Name | [4-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 55350391 |
| Molecular Formula | C17H27N5O5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [4-methyl-1-[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]hydrazinyl]-1-oxopentan-2-yl]urea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NNC(=O)C(CC(C)C)NC(N)=O)cc1 |
| InChI | InChI=1S/C17H27N5O5S/c1-11(2)9-14(19-17(18)25)16(24)21-20-15(23)10-22(4)28(26,27)13-7-5-12(3)6-8-13/h5-8,11,14H,9-10H2,1-4H3,(H,20,23)(H,21,24)(H3,18,19,25) |
| InChIKey | KFNKLKPNZSMHCH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|