C12H21N — CID 100947708
1-(2,6-dimethylcyclohexen-1-yl)pyrrolidine (PubChem CID 100947708) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohexen-1-yl)pyrrolidine.
| Compound Name | 1-(2,6-dimethylcyclohexen-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 100947708 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-(2,6-dimethylcyclohexen-1-yl)pyrrolidine |
| SMILES | CC1=C(N2CCCC2)C(C)CCC1 |
| InChI | InChI=1S/C12H21N/c1-10-6-5-7-11(2)12(10)13-8-3-4-9-13/h10H,3-9H2,1-2H3 |
| InChIKey | NFKLKMMFKNTPJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |