C13H23N — CID 134992735
2,5-dimethyl-1-(2-methylcyclohexen-1-yl)pyrrolidine (PubChem CID 134992735) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2-methylcyclohexen-1-yl)pyrrolidine.
| Compound Name | 2,5-dimethyl-1-(2-methylcyclohexen-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 134992735 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,5-dimethyl-1-(2-methylcyclohexen-1-yl)pyrrolidine |
| SMILES | CC1=C(N2C(C)CCC2C)CCCC1 |
| InChI | InChI=1S/C13H23N/c1-10-6-4-5-7-13(10)14-11(2)8-9-12(14)3/h11-12H,4-9H2,1-3H3 |
| InChIKey | GLPNDMOEHCWOJQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |