About 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine
4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine (PubChem CID 167142420) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine.
Analyze 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine (CID 167142420) is 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine is CC1=C(C)N(C)C(C)CC1F.
What is the InChIKey of 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine?
The InChIKey is TVQLSKWEBLNMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN/c1-6-5-9(10)7(2)8(3)11(6)4/h6,9H,5H2,1-4H3.
What are the key properties of 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine?
4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine has a molecular weight of 157.23 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2,5,6-tetramethyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 167142420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).