C19H28O3 — CID 100948931
(3R,4aR,7R)-7-(4,4-dimethylcyclohexen-1-yl)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-one (PubChem CID 100948931) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3R,4aR,7R)-7-(4,4-dimethylcyclohexen-1-yl)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-one.
| Compound Name | (3R,4aR,7R)-7-(4,4-dimethylcyclohexen-1-yl)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-one |
|---|---|
| PubChem CID | 100948931 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3R,4aR,7R)-7-(4,4-dimethylcyclohexen-1-yl)-3-ethoxy-3,4,4a,5,6,7-hexahydroisochromen-8-one |
| SMILES | CCO[C@H]1C[C@H]2CC[C@H](C3=CCC(C)(C)CC3)C(=O)C2=CO1 |
| InChI | InChI=1S/C19H28O3/c1-4-21-17-11-14-5-6-15(18(20)16(14)12-22-17)13-7-9-19(2,3)10-8-13/h7,12,14-15,17H,4-6,8-11H2,1-3H3/t14-,15-,17-/m1/s1 |
| InChIKey | KMPGBCHUQXTCPG-BFYDXBDKSA-N |
| XLogP | 4.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|