C19H28O3 — CID 170070098
(5S,5aR,6S,9aS)-5-ethoxy-9,9-dimethyl-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one (PubChem CID 170070098) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (5S,5aR,6S,9aS)-5-ethoxy-9,9-dimethyl-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one.
| Compound Name | (5S,5aR,6S,9aS)-5-ethoxy-9,9-dimethyl-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one |
|---|---|
| PubChem CID | 170070098 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5S,5aR,6S,9aS)-5-ethoxy-9,9-dimethyl-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one |
| SMILES | C=C(C)[C@H]1CCC(C)(C)[C@H]2C3=C(CCC3=O)O[C@H](OCC)[C@H]12 |
| InChI | InChI=1S/C19H28O3/c1-6-21-18-15-12(11(2)3)9-10-19(4,5)17(15)16-13(20)7-8-14(16)22-18/h12,15,17-18H,2,6-10H2,1,3-5H3/t12-,15-,17-,18+/m1/s1 |
| InChIKey | CRBFRLHXRGWHTO-QVDUIBETSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|