C18H30O3 — CID 46184393
(4aR,7R,8S,8aR)-8-(2,2-dimethoxyethyl)-4,4a,7,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 46184393) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4aR,7R,8S,8aR)-8-(2,2-dimethoxyethyl)-4,4a,7,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,7R,8S,8aR)-8-(2,2-dimethoxyethyl)-4,4a,7,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 46184393 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4aR,7R,8S,8aR)-8-(2,2-dimethoxyethyl)-4,4a,7,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | COC(C[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=CC(=O)C[C@H]12)OC |
| InChI | InChI=1S/C18H30O3/c1-12-7-8-17(3)13(2)9-14(19)10-15(17)18(12,4)11-16(20-5)21-6/h9,12,15-16H,7-8,10-11H2,1-6H3/t12-,15+,17+,18+/m1/s1 |
| InChIKey | SSCAIKILNLZTJY-VFAJRCTISA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|