C18H24O3 — CID 162415918
(5S,5aR,6S,9aS)-5-ethoxy-9-methylidene-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one (PubChem CID 162415918) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (5S,5aR,6S,9aS)-5-ethoxy-9-methylidene-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one.
| Compound Name | (5S,5aR,6S,9aS)-5-ethoxy-9-methylidene-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one |
|---|---|
| PubChem CID | 162415918 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (5S,5aR,6S,9aS)-5-ethoxy-9-methylidene-6-prop-1-en-2-yl-2,3,5,5a,6,7,8,9a-octahydrocyclopenta[c]isochromen-1-one |
| SMILES | C=C1CC[C@H](C(=C)C)[C@H]2[C@@H](OCC)OC3=C(C(=O)CC3)[C@H]12 |
| InChI | InChI=1S/C18H24O3/c1-5-20-18-16-12(10(2)3)7-6-11(4)15(16)17-13(19)8-9-14(17)21-18/h12,15-16,18H,2,4-9H2,1,3H3/t12-,15-,16-,18+/m1/s1 |
| InChIKey | PNPRAQZMTIFEKZ-YMCQQKJTSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|