About 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene
5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene (PubChem CID 100951032) has the molecular formula C10H10S
and a molecular weight of 162.26 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene.
Analyze 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene?
The IUPAC name of 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene (CID 100951032) is 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene.
What is the SMILES notation for 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene?
The canonical SMILES for 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene is C1=CC(SC2C=CC=C2)C=C1.
What is the InChIKey of 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene?
The InChIKey is APLKRPPSTSZXBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10S/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-10H.
What are the key properties of 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene?
5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene has a molecular weight of 162.26 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-2,4-dien-1-ylsulfanylcyclopenta-1,3-diene is sourced from PubChem (CID 100951032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).