C22H40 — CID 100951216
(5E)-3,8-ditert-butyl-2,2,9,9-tetramethyldeca-3,5,7-triene (PubChem CID 100951216) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is (5E)-3,8-ditert-butyl-2,2,9,9-tetramethyldeca-3,5,7-triene.
| Compound Name | (5E)-3,8-ditert-butyl-2,2,9,9-tetramethyldeca-3,5,7-triene |
|---|---|
| PubChem CID | 100951216 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | (5E)-3,8-ditert-butyl-2,2,9,9-tetramethyldeca-3,5,7-triene |
| SMILES | CC(C)(C)C(=C/C=C/C=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H40/c1-19(2,3)17(20(4,5)6)15-13-14-16-18(21(7,8)9)22(10,11)12/h13-16H,1-12H3/b14-13+ |
| InChIKey | WVHKHHYKIJKJLI-BUHFOSPRSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|