C15H7F6N3O — CID 100951468
2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone (PubChem CID 100951468) has the molecular formula C15H7F6N3O and a molecular weight of 359.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone |
|---|---|
| PubChem CID | 100951468 |
| Molecular Formula | C15H7F6N3O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-methyl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone |
| SMILES | Cc1nc(C(F)(F)F)c2cc(C(=O)C(F)(F)F)c3cccnc3c2n1 |
| InChI | InChI=1S/C15H7F6N3O/c1-6-23-11-9(12(24-6)14(16,17)18)5-8(13(25)15(19,20)21)7-3-2-4-22-10(7)11/h2-5H,1H3 |
| InChIKey | UCIZRJIQYRDRTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|