C17H11F6N3O — CID 100951470
2,2,2-trifluoro-1-[2-propan-2-yl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone (PubChem CID 100951470) has the molecular formula C17H11F6N3O and a molecular weight of 387.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-propan-2-yl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-propan-2-yl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone |
|---|---|
| PubChem CID | 100951470 |
| Molecular Formula | C17H11F6N3O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-propan-2-yl-4-(trifluoromethyl)pyrido[3,2-h]quinazolin-6-yl]ethanone |
| SMILES | CC(C)c1nc(C(F)(F)F)c2cc(C(=O)C(F)(F)F)c3cccnc3c2n1 |
| InChI | InChI=1S/C17H11F6N3O/c1-7(2)15-25-12-10(13(26-15)16(18,19)20)6-9(14(27)17(21,22)23)8-4-3-5-24-11(8)12/h3-7H,1-2H3 |
| InChIKey | NYDBRHSBTBRWOI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|