C13H12O2 — CID 100951712
(1S,5R)-6-phenyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 100951712) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (1S,5R)-6-phenyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,5R)-6-phenyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 100951712 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (1S,5R)-6-phenyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1C[C@H]2C=C(c3ccccc3)[C@@H](C1)O2 |
| InChI | InChI=1S/C13H12O2/c14-10-6-11-8-12(13(7-10)15-11)9-4-2-1-3-5-9/h1-5,8,11,13H,6-7H2/t11-,13+/m0/s1 |
| InChIKey | BZHLVALCHWUVEH-WCQYABFASA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |