C18H18ClNO4 — CID 100951906
4-[1-[[(1S)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-2-oxoethyl]benzoic acid (PubChem CID 100951906) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 4-[1-[[(1S)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[1-[[(1S)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 100951906 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[1-[[(1S)-1-(5-chloro-2-methoxyphenyl)ethyl]amino]-2-oxoethyl]benzoic acid |
| SMILES | COc1ccc(Cl)cc1[C@H](C)NC(C=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H18ClNO4/c1-11(15-9-14(19)7-8-17(15)24-2)20-16(10-21)12-3-5-13(6-4-12)18(22)23/h3-11,16,20H,1-2H3,(H,22,23)/t11-,16?/m0/s1 |
| InChIKey | CUNZHJUJFVAGBV-CHPOKUKFSA-N |
| XLogP | 3.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|