C21H26ClNO4 — CID 143126009
5-chloro-2-(2-methylpropoxy)benzaldehyde;4-[1-(methylamino)ethyl]benzoic acid (PubChem CID 143126009) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 5-chloro-2-(2-methylpropoxy)benzaldehyde;4-[1-(methylamino)ethyl]benzoic acid.
| Compound Name | 5-chloro-2-(2-methylpropoxy)benzaldehyde;4-[1-(methylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 143126009 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-chloro-2-(2-methylpropoxy)benzaldehyde;4-[1-(methylamino)ethyl]benzoic acid |
| SMILES | CC(C)COc1ccc(Cl)cc1C=O.CNC(C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H13ClO2.C10H13NO2/c1-8(2)7-14-11-4-3-10(12)5-9(11)6-13;1-7(11-2)8-3-5-9(6-4-8)10(12)13/h3-6,8H,7H2,1-2H3;3-7,11H,1-2H3,(H,12,13) |
| InChIKey | CFTAKHUFARJPJA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|