About 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate
5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate (PubChem CID 91709356) has the molecular formula C16H19ClO5
and a molecular weight of 326.78 g/mol. Its IUPAC name is 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate.
Molecular Properties
| Compound Name | 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate |
| PubChem CID | 91709356 |
| Molecular Formula | C16H19ClO5 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate |
| SMILES | CC(C)COC(=O)CCCC(=O)Oc1ccc(Cl)cc1C=O |
| InChI | InChI=1S/C16H19ClO5/c1-11(2)10-21-15(19)4-3-5-16(20)22-14-7-6-13(17)8-12(14)9-18/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | DRKFRKYSWLAMIM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate?
The IUPAC name of 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate (CID 91709356) is 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate.
What is the SMILES notation for 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate?
The canonical SMILES for 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate is CC(C)COC(=O)CCCC(=O)Oc1ccc(Cl)cc1C=O.
What is the InChIKey of 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate?
The InChIKey is DRKFRKYSWLAMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClO5/c1-11(2)10-21-15(19)4-3-5-16(20)22-14-7-6-13(17)8-12(14)9-18/h6-9,11H,3-5,10H2,1-2H3.
What are the key properties of 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate?
5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate has a molecular weight of 326.78 g/mol, XLogP of 3.43, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(4-chloro-2-formylphenyl) 1-O-(2-methylpropyl) pentanedioate is sourced from PubChem (CID 91709356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).